methyl 2,5-dichloropyridine-3-carboxylate - Names and Identifiers
Name | methyl 2,5-dichloropyridine-3-carboxylate
|
Synonyms | METHYL 2,5-DICHLORONICOTINATE Methyl 2,5-dichloronicotinate 5-dichloropyridine-3-carboxylate 2,5-Dichloro-nicotinic acid Methyl ester methyl 2,5-dichloropyridine-3-carboxylate Methyl 2,5-dichloropyridine-3-carboxylate 2,5-dichloro-3-pyridinecarboxylic acid methyl ester 3-pyridinecarboxylic acid, 2,5-dichloro-, methyl ester 3-Pyridinecarboxylic acid, 2,5-dichloro-, Methyl ester Methyl 2,5-dichloropyridine-3-carboxylate, 2,5-Dichloro-3-(methoxycarbonyl)pyridine
|
CAS | 67754-03-4
|
InChI | InChI=1/C7H5Cl2NO2/c1-12-7(11)5-2-4(8)3-10-6(5)9/h2-3H,1H3 |
methyl 2,5-dichloropyridine-3-carboxylate - Physico-chemical Properties
Molecular Formula | C7H5Cl2NO2
|
Molar Mass | 206.03 |
Density | 1.426 |
Melting Point | 38-40°C |
Boling Point | 267℃ |
Flash Point | 115℃ |
Vapor Presure | 0.00852mmHg at 25°C |
Appearance | Low melting point solid |
Color | White to Almost white |
pKa | -3.78±0.10(Predicted) |
Storage Condition | Inert atmosphere,Room Temperature |
Refractive Index | 1.548 |
methyl 2,5-dichloropyridine-3-carboxylate - Risk and Safety
methyl 2,5-dichloropyridine-3-carboxylate - Introduction
Methyl 2, is an organic compound with the chemical formula C7H4Cl2NO2. The following is a description of the properties, uses, preparation and safety information of the compound:
Nature:
- methyl 2, is a colorless liquid.
-It has a pungent pungent odor.
-The compound is soluble in an organic solvent such as methanol or dichloromethane.
-Its melting point is about 43-47°C, and its boiling point is about 257-263°C.
Use:
- methyl 2, commonly used as a synthetic intermediate for pesticides and insecticides.
-It can also be used to synthesize other compounds in organic synthetic chemistry.
Preparation Method:
- methyl 2, can be prepared by the following steps:
1. First, 2,5-dichloronicotinic acid is esterified with formic acid.
2. The reaction is usually carried out under acidic conditions, and an esterifying agent, such as an alcohol or an acid catalyst, is added to promote the reaction.
3. After the reaction is completed, the target product is separated and purified from the reaction mixture by distillation or extraction.
Safety Information:
- methyl 2, is an irritating compound that may have an irritating effect on the eyes, skin and mucous membranes.
-Wear appropriate personal protective equipment such as glasses, gloves and protective clothing when handling and using.
-It should be away from fire and high temperature environment to prevent the risk of fire and explosion.
-When storing and handling, strictly follow the safety operation procedures to avoid mixing and contact with other substances.
-If ingested or inhaled, seek medical attention immediately and provide a safety data sheet or label for the chemical.
Last Update:2024-04-10 22:29:15